About 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone
1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone (PubChem CID 86663167) has the molecular formula C12H15ClN4O2
and a molecular weight of 282.73 g/mol. Its IUPAC name is 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
| PubChem CID | 86663167 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
| SMILES | CC(=O)N1Cc2nc(Cl)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C12H15ClN4O2/c1-8(18)17-6-9-10(7-17)14-12(13)15-11(9)16-2-4-19-5-3-16/h2-7H2,1H3 |
| InChIKey | SISQAWRNIMHDNW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The IUPAC name of 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone (CID 86663167) is 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone.
What is the SMILES notation for 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The canonical SMILES for 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone is CC(=O)N1Cc2nc(Cl)nc(N3CCOCC3)c2C1.
What is the InChIKey of 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The InChIKey is SISQAWRNIMHDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4O2/c1-8(18)17-6-9-10(7-17)14-12(13)15-11(9)16-2-4-19-5-3-16/h2-7H2,1H3.
What are the key properties of 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone has a molecular weight of 282.73 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-morpholin-4-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone is sourced from PubChem (CID 86663167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).