C14H17BrN4O — CID 86663181
2'-amino-2-bromo-3',6,6-trimethylspiro[5,7-dihydroquinoline-8,5'-imidazole]-4'-one (PubChem CID 86663181) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 2'-amino-2-bromo-3',6,6-trimethylspiro[5,7-dihydroquinoline-8,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-2-bromo-3',6,6-trimethylspiro[5,7-dihydroquinoline-8,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 86663181 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2'-amino-2-bromo-3',6,6-trimethylspiro[5,7-dihydroquinoline-8,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)C2(CC(C)(C)Cc3ccc(Br)nc32)N=C1N |
| InChI | InChI=1S/C14H17BrN4O/c1-13(2)6-8-4-5-9(15)17-10(8)14(7-13)11(20)19(3)12(16)18-14/h4-5H,6-7H2,1-3H3,(H2,16,18) |
| InChIKey | OPXKFBVGDVQRDK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|