C17H15F3N2O3 — CID 86663337
N-cyclopentyl-4-formyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 86663337) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-cyclopentyl-4-formyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyclopentyl-4-formyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 86663337 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-cyclopentyl-4-formyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=Cc1c(C(=O)NC2CCCC2)noc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N2O3/c18-17(19,20)11-7-5-10(6-8-11)15-13(9-23)14(22-25-15)16(24)21-12-3-1-2-4-12/h5-9,12H,1-4H2,(H,21,24) |
| InChIKey | YTRHJVVUDYKSRJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|