C19H22N4O5 — CID 86663569
7-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxyheptanoic acid (PubChem CID 86663569) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 7-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxyheptanoic acid.
| Compound Name | 7-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 86663569 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 7-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxyheptanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCC(O)CCCC(=O)O)c2cc1C |
| InChI | InChI=1S/C19H22N4O5/c1-10-8-13-14(9-11(10)2)23(7-6-12(24)4-3-5-15(25)26)17-16(20-13)18(27)22-19(28)21-17/h8-9,12,24H,3-7H2,1-2H3,(H,25,26)(H,22,27,28) |
| InChIKey | ZVCVYZYXFLHXHJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|