C18H21N5O4 — CID 86663571
6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-N-hydroxyhexanamide (PubChem CID 86663571) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 86663571 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 6-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-N-hydroxyhexanamide |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCCC(=O)NO)c2cc1C |
| InChI | InChI=1S/C18H21N5O4/c1-10-8-12-13(9-11(10)2)23(7-5-3-4-6-14(24)22-27)16-15(19-12)17(25)21-18(26)20-16/h8-9,27H,3-7H2,1-2H3,(H,22,24)(H,21,25,26) |
| InChIKey | QHVNJAMTVZFTCH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|