C29H34N6O4 — CID 86663597
4-[benzyl-[2-[8-(cyclopentylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]ethyl]amino]butanoic acid (PubChem CID 86663597) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is 4-[benzyl-[2-[8-(cyclopentylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]ethyl]amino]butanoic acid.
| Compound Name | 4-[benzyl-[2-[8-(cyclopentylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 86663597 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 4-[benzyl-[2-[8-(cyclopentylamino)-7-methyl-2,4-dioxobenzo[g]pteridin-10-yl]ethyl]amino]butanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCN(CCCC(=O)O)Cc3ccccc3)c2cc1NC1CCCC1 |
| InChI | InChI=1S/C29H34N6O4/c1-19-16-23-24(17-22(19)30-21-10-5-6-11-21)35(27-26(31-23)28(38)33-29(39)32-27)15-14-34(13-7-12-25(36)37)18-20-8-3-2-4-9-20/h2-4,8-9,16-17,21,30H,5-7,10-15,18H2,1H3,(H,36,37)(H,33,38,39) |
| InChIKey | NHFZPRWRGJOHIV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|