C28H27N5O8S — CID 86663632
[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(sulfamoyloxymethyl)cyclopentyl] 4-nitrobenzoate (PubChem CID 86663632) has the molecular formula C28H27N5O8S and a molecular weight of 593.62 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(sulfamoyloxymethyl)cyclopentyl] 4-nitrobenzoate.
| Compound Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(sulfamoyloxymethyl)cyclopentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 86663632 |
| Molecular Formula | C28H27N5O8S |
| Molecular Weight | 593.62 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(sulfamoyloxymethyl)cyclopentyl] 4-nitrobenzoate |
| SMILES | NS(=O)(=O)OC[C@@H]1C[C@@H](c2coc3c(N[C@H]4CCc5ccccc54)ncnc23)C[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H27N5O8S/c29-42(37,38)40-13-19-11-18(12-24(19)41-28(34)17-5-8-20(9-6-17)33(35)36)22-14-39-26-25(22)30-15-31-27(26)32-23-10-7-16-3-1-2-4-21(16)23/h1-6,8-9,14-15,18-19,23-24H,7,10-13H2,(H2,29,37,38)(H,30,31,32)/t18-,19+,23+,24+/m1/s1 |
| InChIKey | UWHADHXGGDFXJD-GABIRTJKSA-N |
| XLogP | 4.17 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|