C29H39F8N3O4S — CID 86663799
N-[4-[4,4-dimethyl-2,5-dioxo-3-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]imidazolidin-1-yl]-2-(trifluoromethyl)phenyl]-N-methylacetamide (PubChem CID 86663799) has the molecular formula C29H39F8N3O4S and a molecular weight of 677.70 g/mol. Its IUPAC name is N-[4-[4,4-dimethyl-2,5-dioxo-3-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]imidazolidin-1-yl]-2-(trifluoromethyl)phenyl]-N-methylacetamide.
| Compound Name | N-[4-[4,4-dimethyl-2,5-dioxo-3-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]imidazolidin-1-yl]-2-(trifluoromethyl)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 86663799 |
| Molecular Formula | C29H39F8N3O4S |
| Molecular Weight | 677.70 g/mol |
| Exact Mass | 677.25 |
| IUPAC Name | N-[4-[4,4-dimethyl-2,5-dioxo-3-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]imidazolidin-1-yl]-2-(trifluoromethyl)phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(N2C(=O)N(CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)C(C)(C)C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C29H39F8N3O4S/c1-20(41)38(4)23-14-13-21(19-22(23)28(32,33)34)40-24(42)26(2,3)39(25(40)43)16-10-8-6-5-7-9-11-17-45(44)18-12-15-27(30,31)29(35,36)37/h13-14,19H,5-12,15-18H2,1-4H3 |
| InChIKey | XZACOELVKLQQSZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.70 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|