C17H17N3O3S — CID 866639
5-(4,4-dimethyl-1,3-oxazolidine-3-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 866639) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-(4,4-dimethyl-1,3-oxazolidine-3-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 5-(4,4-dimethyl-1,3-oxazolidine-3-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 866639 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-(4,4-dimethyl-1,3-oxazolidine-3-carbonyl)-10-methyl-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)N4COCC4(C)C)sc3nc12 |
| InChI | InChI=1S/C17H17N3O3S/c1-10-5-4-6-19-13(10)18-14-11(15(19)21)7-12(24-14)16(22)20-9-23-8-17(20,2)3/h4-7H,8-9H2,1-3H3 |
| InChIKey | RHIKMYNCHKGIPM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |