About 6,7,7-trifluorohept-6-ene-1,3-diol
6,7,7-trifluorohept-6-ene-1,3-diol (PubChem CID 86664076) has the molecular formula C7H11F3O2
and a molecular weight of 184.16 g/mol. Its IUPAC name is 6,7,7-trifluorohept-6-ene-1,3-diol.
Molecular Properties
| Compound Name | 6,7,7-trifluorohept-6-ene-1,3-diol |
| PubChem CID | 86664076 |
| Molecular Formula | C7H11F3O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6,7,7-trifluorohept-6-ene-1,3-diol |
| SMILES | OCCC(O)CCC(F)=C(F)F |
| InChI | InChI=1S/C7H11F3O2/c8-6(7(9)10)2-1-5(12)3-4-11/h5,11-12H,1-4H2 |
| InChIKey | NLGQJHQDUWHEMX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7,7-trifluorohept-6-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,7-trifluorohept-6-ene-1,3-diol?
The IUPAC name of 6,7,7-trifluorohept-6-ene-1,3-diol (CID 86664076) is 6,7,7-trifluorohept-6-ene-1,3-diol.
What is the SMILES notation for 6,7,7-trifluorohept-6-ene-1,3-diol?
The canonical SMILES for 6,7,7-trifluorohept-6-ene-1,3-diol is OCCC(O)CCC(F)=C(F)F.
What is the InChIKey of 6,7,7-trifluorohept-6-ene-1,3-diol?
The InChIKey is NLGQJHQDUWHEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3O2/c8-6(7(9)10)2-1-5(12)3-4-11/h5,11-12H,1-4H2.
What are the key properties of 6,7,7-trifluorohept-6-ene-1,3-diol?
6,7,7-trifluorohept-6-ene-1,3-diol has a molecular weight of 184.16 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,7-trifluorohept-6-ene-1,3-diol is sourced from PubChem (CID 86664076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).