C26H18Br2N2 — CID 86664282
5-(2,6-dibromo-4-pyridinyl)-11,11-dimethylindeno[1,2-b]carbazole (PubChem CID 86664282) has the molecular formula C26H18Br2N2 and a molecular weight of 518.25 g/mol. Its IUPAC name is 5-(2,6-dibromo-4-pyridinyl)-11,11-dimethylindeno[1,2-b]carbazole.
| Compound Name | 5-(2,6-dibromo-4-pyridinyl)-11,11-dimethylindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 86664282 |
| Molecular Formula | C26H18Br2N2 |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 5-(2,6-dibromo-4-pyridinyl)-11,11-dimethylindeno[1,2-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C26H18Br2N2/c1-26(2)20-9-5-3-7-16(20)18-14-23-19(13-21(18)26)17-8-4-6-10-22(17)30(23)15-11-24(27)29-25(28)12-15/h3-14H,1-2H3 |
| InChIKey | RLYTXIQWPWYOQT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|