C21H20N2O4 — CID 86664533
[(8S,10R)-1-benzyl-8-methyl-3-oxo-7,8,9,10-tetrahydropyrano[3,2-f]quinolin-10-yl] carbamate (PubChem CID 86664533) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is [(8S,10R)-1-benzyl-8-methyl-3-oxo-7,8,9,10-tetrahydropyrano[3,2-f]quinolin-10-yl] carbamate.
| Compound Name | [(8S,10R)-1-benzyl-8-methyl-3-oxo-7,8,9,10-tetrahydropyrano[3,2-f]quinolin-10-yl] carbamate |
|---|---|
| PubChem CID | 86664533 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [(8S,10R)-1-benzyl-8-methyl-3-oxo-7,8,9,10-tetrahydropyrano[3,2-f]quinolin-10-yl] carbamate |
| SMILES | C[C@H]1C[C@@H](OC(N)=O)c2c(ccc3oc(=O)cc(Cc4ccccc4)c23)N1 |
| InChI | InChI=1S/C21H20N2O4/c1-12-9-17(27-21(22)25)20-15(23-12)7-8-16-19(20)14(11-18(24)26-16)10-13-5-3-2-4-6-13/h2-8,11-12,17,23H,9-10H2,1H3,(H2,22,25)/t12-,17+/m0/s1 |
| InChIKey | WXYULUBIPQTHNL-YVEFUNNKSA-N |
| XLogP | 3.72 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|