C24H26ClN5O2 — CID 86664619
2-tert-butyl-1'-(1-chloroisoquinoline-7-carbonyl)spiro[4,6-dihydropyrazolo[3,4-c]pyridine-5,4'-piperidine]-7-one (PubChem CID 86664619) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is 2-tert-butyl-1'-(1-chloroisoquinoline-7-carbonyl)spiro[4,6-dihydropyrazolo[3,4-c]pyridine-5,4'-piperidine]-7-one.
| Compound Name | 2-tert-butyl-1'-(1-chloroisoquinoline-7-carbonyl)spiro[4,6-dihydropyrazolo[3,4-c]pyridine-5,4'-piperidine]-7-one |
|---|---|
| PubChem CID | 86664619 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-tert-butyl-1'-(1-chloroisoquinoline-7-carbonyl)spiro[4,6-dihydropyrazolo[3,4-c]pyridine-5,4'-piperidine]-7-one |
| SMILES | CC(C)(C)n1cc2c(n1)C(=O)NC1(CCN(C(=O)c3ccc4ccnc(Cl)c4c3)CC1)C2 |
| InChI | InChI=1S/C24H26ClN5O2/c1-23(2,3)30-14-17-13-24(27-21(31)19(17)28-30)7-10-29(11-8-24)22(32)16-5-4-15-6-9-26-20(25)18(15)12-16/h4-6,9,12,14H,7-8,10-11,13H2,1-3H3,(H,27,31) |
| InChIKey | LFZDQWVIOIYHBD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|