About 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine
2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine (PubChem CID 86664620) has the molecular formula C8H4Cl2F3N
and a molecular weight of 242.03 g/mol. Its IUPAC name is 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine |
| PubChem CID | 86664620 |
| Molecular Formula | C8H4Cl2F3N |
| Molecular Weight | 242.03 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine |
| SMILES | C=C(c1cc(Cl)nc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F3N/c1-4(8(11,12)13)5-2-6(9)14-7(10)3-5/h2-3H,1H2 |
| InChIKey | UXTQQHLQEMOMOY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.03 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The IUPAC name of 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine (CID 86664620) is 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine.
What is the SMILES notation for 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The canonical SMILES for 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine is C=C(c1cc(Cl)nc(Cl)c1)C(F)(F)F.
What is the InChIKey of 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The InChIKey is UXTQQHLQEMOMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2F3N/c1-4(8(11,12)13)5-2-6(9)14-7(10)3-5/h2-3H,1H2.
What are the key properties of 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine has a molecular weight of 242.03 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(3,3,3-trifluoroprop-1-en-2-yl)pyridine is sourced from PubChem (CID 86664620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).