C45H64FN7O4Si2 — CID 86664797
tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]-N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamate (PubChem CID 86664797) has the molecular formula C45H64FN7O4Si2 and a molecular weight of 842.22 g/mol. Its IUPAC name is tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]-N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]-N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 86664797 |
| Molecular Formula | C45H64FN7O4Si2 |
| Molecular Weight | 842.22 g/mol |
| Exact Mass | 841.45 |
| IUPAC Name | tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]-N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCN(Cc2ccccc2)CC1)c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n2ncc(-c3cnc4ccc(F)cc4c3)c2n1 |
| InChI | InChI=1S/C45H64FN7O4Si2/c1-45(2,3)57-44(54)52(31-35-17-19-50(20-18-35)30-34-13-11-10-12-14-34)41-27-42(51(32-55-21-23-58(4,5)6)33-56-22-24-59(7,8)9)53-43(49-41)39(29-48-53)37-25-36-26-38(46)15-16-40(36)47-28-37/h10-16,25-29,35H,17-24,30-33H2,1-9H3 |
| InChIKey | LTURABRHGNVYBF-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 97.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.22 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|