About 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate
8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate (PubChem CID 86664801) has the molecular formula C12H16NO3-
and a molecular weight of 222.26 g/mol. Its IUPAC name is 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate.
Molecular Properties
| Compound Name | 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate |
| PubChem CID | 86664801 |
| Molecular Formula | C12H16NO3- |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate |
| SMILES | CCC(=O)[O-].Cc1cccc2c1OCCN2 |
| InChI | InChI=1S/C9H11NO.C3H6O2/c1-7-3-2-4-8-9(7)11-6-5-10-8;1-2-3(4)5/h2-4,10H,5-6H2,1H3;2H2,1H3,(H,4,5)/p-1 |
| InChIKey | NUHQYWUOLABQTC-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate?
The IUPAC name of 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate (CID 86664801) is 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate.
What is the SMILES notation for 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate?
The canonical SMILES for 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate is CCC(=O)[O-].Cc1cccc2c1OCCN2.
What is the InChIKey of 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate?
The InChIKey is NUHQYWUOLABQTC-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11NO.C3H6O2/c1-7-3-2-4-8-9(7)11-6-5-10-8;1-2-3(4)5/h2-4,10H,5-6H2,1H3;2H2,1H3,(H,4,5)/p-1.
What are the key properties of 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate?
8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate has a molecular weight of 222.26 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,4-dihydro-2H-1,4-benzoxazine;propanoate is sourced from PubChem (CID 86664801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).