About 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide
2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide (PubChem CID 86664913) has the molecular formula C11H8N4O3S
and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide.
Molecular Properties
| Compound Name | 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide |
| PubChem CID | 86664913 |
| Molecular Formula | C11H8N4O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide |
| SMILES | CC(=O)c1ccc(Cc2nc(C(=O)N=[N+]=[N-])co2)s1 |
| InChI | InChI=1S/C11H8N4O3S/c1-6(16)9-3-2-7(19-9)4-10-13-8(5-18-10)11(17)14-15-12/h2-3,5H,4H2,1H3 |
| InChIKey | MREVAHTWBQUZNB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 108.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide?
The IUPAC name of 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide (CID 86664913) is 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide.
What is the SMILES notation for 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide?
The canonical SMILES for 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide is CC(=O)c1ccc(Cc2nc(C(=O)N=[N+]=[N-])co2)s1.
What is the InChIKey of 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide?
The InChIKey is MREVAHTWBQUZNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O3S/c1-6(16)9-3-2-7(19-9)4-10-13-8(5-18-10)11(17)14-15-12/h2-3,5H,4H2,1H3.
What are the key properties of 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide?
2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide has a molecular weight of 276.28 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-acetylthiophen-2-yl)methyl]-1,3-oxazole-4-carbonyl azide is sourced from PubChem (CID 86664913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).