About 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine
2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine (PubChem CID 86665115) has the molecular formula C8H6ClF2N3O
and a molecular weight of 233.60 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 86665115 |
| Molecular Formula | C8H6ClF2N3O |
| Molecular Weight | 233.60 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)CNc1nc(Cl)nc2ccoc12 |
| InChI | InChI=1S/C8H6ClF2N3O/c9-8-13-4-1-2-15-6(4)7(14-8)12-3-5(10)11/h1-2,5H,3H2,(H,12,13,14) |
| InChIKey | ABONCOPQJOGNLA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine (CID 86665115) is 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine is FC(F)CNc1nc(Cl)nc2ccoc12.
What is the InChIKey of 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine?
The InChIKey is ABONCOPQJOGNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF2N3O/c9-8-13-4-1-2-15-6(4)7(14-8)12-3-5(10)11/h1-2,5H,3H2,(H,12,13,14).
What are the key properties of 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine?
2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine has a molecular weight of 233.60 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,2-difluoroethyl)furo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 86665115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).