C26H24F6O5S2 — CID 86665359
2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;(4-fluorophenyl)-diphenylsulfanium (PubChem CID 86665359) has the molecular formula C26H24F6O5S2 and a molecular weight of 594.60 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;(4-fluorophenyl)-diphenylsulfanium.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;(4-fluorophenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 86665359 |
| Molecular Formula | C26H24F6O5S2 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;(4-fluorophenyl)-diphenylsulfanium |
| SMILES | CC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].Fc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14FS.C8H11F5O5S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-6(2,3)5(14)18-4(7(9,10)11)8(12,13)19(15,16)17/h1-14H;4H,1-3H3,(H,15,16,17)/q+1;/p-1 |
| InChIKey | LIUJAXDYXMILNI-UHFFFAOYSA-M |
| XLogP | 6.57 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|