C20H22F3N5O3S2 — CID 86665469
1-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]-3-(2-propan-2-yloxy-5-sulfamoylphenyl)thiourea (PubChem CID 86665469) has the molecular formula C20H22F3N5O3S2 and a molecular weight of 501.56 g/mol. Its IUPAC name is 1-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]-3-(2-propan-2-yloxy-5-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]-3-(2-propan-2-yloxy-5-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 86665469 |
| Molecular Formula | C20H22F3N5O3S2 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 1-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]-3-(2-propan-2-yloxy-5-sulfamoylphenyl)thiourea |
| SMILES | Cc1nc2cccc(NC(=S)Nc3cc(S(N)(=O)=O)ccc3OC(C)C)c2n1CC(F)(F)F |
| InChI | InChI=1S/C20H22F3N5O3S2/c1-11(2)31-17-8-7-13(33(24,29)30)9-16(17)27-19(32)26-15-6-4-5-14-18(15)28(12(3)25-14)10-20(21,22)23/h4-9,11H,10H2,1-3H3,(H2,24,29,30)(H2,26,27,32) |
| InChIKey | UMPOSDGQLHEDBN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|