C21H23F3N4O3S2 — CID 86665476
1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea (PubChem CID 86665476) has the molecular formula C21H23F3N4O3S2 and a molecular weight of 500.57 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea.
| Compound Name | 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
|---|---|
| PubChem CID | 86665476 |
| Molecular Formula | C21H23F3N4O3S2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[2-methyl-3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
| SMILES | Cc1nc2cccc(NC(=S)Nc3cc(S(C)(=O)=O)ccc3OC(C)C)c2n1CC(F)(F)F |
| InChI | InChI=1S/C21H23F3N4O3S2/c1-12(2)31-18-9-8-14(33(4,29)30)10-17(18)27-20(32)26-16-7-5-6-15-19(16)28(13(3)25-15)11-21(22,23)24/h5-10,12H,11H2,1-4H3,(H2,26,27,32) |
| InChIKey | RTCIRUNKYJEXJF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|