C20H21F3N4O3S2 — CID 86665477
1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea (PubChem CID 86665477) has the molecular formula C20H21F3N4O3S2 and a molecular weight of 486.54 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea.
| Compound Name | 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
|---|---|
| PubChem CID | 86665477 |
| Molecular Formula | C20H21F3N4O3S2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-(5-methylsulfonyl-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
| SMILES | CC(C)Oc1ccc(S(C)(=O)=O)cc1NC(=S)Nc1cccc2ncn(CC(F)(F)F)c12 |
| InChI | InChI=1S/C20H21F3N4O3S2/c1-12(2)30-17-8-7-13(32(3,28)29)9-16(17)26-19(31)25-15-6-4-5-14-18(15)27(11-24-14)10-20(21,22)23/h4-9,11-12H,10H2,1-3H3,(H2,25,26,31) |
| InChIKey | AESHXBMHABHBEP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|