C18H19ClN4O2S2 — CID 86665559
3-[[4-[2-(chloromethyl)-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide (PubChem CID 86665559) has the molecular formula C18H19ClN4O2S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 3-[[4-[2-(chloromethyl)-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide.
| Compound Name | 3-[[4-[2-(chloromethyl)-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 86665559 |
| Molecular Formula | C18H19ClN4O2S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-[[4-[2-(chloromethyl)-4-methyl-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide |
| SMILES | Cc1nc(CCl)sc1-c1csc(Nc2cc(C(N)=O)ccc2OC(C)C)n1 |
| InChI | InChI=1S/C18H19ClN4O2S2/c1-9(2)25-14-5-4-11(17(20)24)6-12(14)22-18-23-13(8-26-18)16-10(3)21-15(7-19)27-16/h4-6,8-9H,7H2,1-3H3,(H2,20,24)(H,22,23) |
| InChIKey | MCICDMLKXSKTPP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|