C17H16F3N5O2S2 — CID 86665619
3-[[4-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide (PubChem CID 86665619) has the molecular formula C17H16F3N5O2S2 and a molecular weight of 443.48 g/mol. Its IUPAC name is 3-[[4-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide.
| Compound Name | 3-[[4-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 86665619 |
| Molecular Formula | C17H16F3N5O2S2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 3-[[4-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]amino]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(N)=O)cc1Nc1nc(-c2sc(N)nc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H16F3N5O2S2/c1-7(2)27-11-4-3-8(14(21)26)5-9(11)23-16-24-10(6-28-16)12-13(17(18,19)20)25-15(22)29-12/h3-7H,1-2H3,(H2,21,26)(H2,22,25)(H,23,24) |
| InChIKey | NQAIVCOXSDCNKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|