About (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate
(2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate (PubChem CID 86665644) has the molecular formula C13H11F3N2O6S
and a molecular weight of 380.30 g/mol. Its IUPAC name is (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate |
| PubChem CID | 86665644 |
| Molecular Formula | C13H11F3N2O6S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate |
| SMILES | O=c1nc(N2CCOCC2)oc2c(OS(=O)(=O)C(F)(F)F)cccc12 |
| InChI | InChI=1S/C13H11F3N2O6S/c14-13(15,16)25(20,21)24-9-3-1-2-8-10(9)23-12(17-11(8)19)18-4-6-22-7-5-18/h1-3H,4-7H2 |
| InChIKey | DTOQOKSLPCDBGB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate?
The IUPAC name of (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate (CID 86665644) is (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate?
The canonical SMILES for (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate is O=c1nc(N2CCOCC2)oc2c(OS(=O)(=O)C(F)(F)F)cccc12.
What is the InChIKey of (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate?
The InChIKey is DTOQOKSLPCDBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O6S/c14-13(15,16)25(20,21)24-9-3-1-2-8-10(9)23-12(17-11(8)19)18-4-6-22-7-5-18/h1-3H,4-7H2.
What are the key properties of (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate?
(2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate has a molecular weight of 380.30 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-4-oxo-1,3-benzoxazin-8-yl) trifluoromethanesulfonate is sourced from PubChem (CID 86665644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).