About N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide
N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide (PubChem CID 86665700) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide |
| PubChem CID | 86665700 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C11H13N3O2/c1-13-7-12-9-6-8(4-5-10(9)13)11(15)14(2)16-3/h4-7H,1-3H3 |
| InChIKey | GUFMXEAHLJLKNT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide?
The IUPAC name of N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide (CID 86665700) is N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide.
What is the SMILES notation for N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide?
The canonical SMILES for N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide is CON(C)C(=O)c1ccc2c(c1)ncn2C.
What is the InChIKey of N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide?
The InChIKey is GUFMXEAHLJLKNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-13-7-12-9-6-8(4-5-10(9)13)11(15)14(2)16-3/h4-7H,1-3H3.
What are the key properties of N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide?
N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide has a molecular weight of 219.24 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,1-dimethylbenzimidazole-5-carboxamide is sourced from PubChem (CID 86665700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).