C15H21NO3 — CID 86665785
tert-butyl 3-formyl-3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboxylate (PubChem CID 86665785) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl 3-formyl-3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 3-formyl-3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 86665785 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl 3-formyl-3,4,4a,5-tetrahydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC=CCC2CC1C=O |
| InChI | InChI=1S/C15H21NO3/c1-15(2,3)19-14(18)16-9-12-7-5-4-6-11(12)8-13(16)10-17/h4-5,7,10-11,13H,6,8-9H2,1-3H3 |
| InChIKey | DYVAIDJMEQTMND-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|