C29H29ClFN5O — CID 86666135
1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]-N-(2-methylpropyl)piperidine-4-carboxamide (PubChem CID 86666135) has the molecular formula C29H29ClFN5O and a molecular weight of 518.04 g/mol. Its IUPAC name is 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]-N-(2-methylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]-N-(2-methylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86666135 |
| Molecular Formula | C29H29ClFN5O |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]-N-(2-methylpropyl)piperidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1CCN(c2nc(-c3ccnc(Cl)c3)c(-c3ccc(F)cc3)c3cnccc23)CC1 |
| InChI | InChI=1S/C29H29ClFN5O/c1-18(2)16-34-29(37)20-9-13-36(14-10-20)28-23-8-11-32-17-24(23)26(19-3-5-22(31)6-4-19)27(35-28)21-7-12-33-25(30)15-21/h3-8,11-12,15,17-18,20H,9-10,13-14,16H2,1-2H3,(H,34,37) |
| InChIKey | WYIIUUKLAIZXGX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|