C24H20ClF2N4O4S2- — CID 86666979
4-chloro-7-[[2,6-difluoro-3-[4-(4-methoxyphenyl)butyl-sulfinatoamino]phenyl]carbamoyl]thieno[3,2-d]pyrimidine (PubChem CID 86666979) has the molecular formula C24H20ClF2N4O4S2- and a molecular weight of 566.03 g/mol. Its IUPAC name is 4-chloro-7-[[2,6-difluoro-3-[4-(4-methoxyphenyl)butyl-sulfinatoamino]phenyl]carbamoyl]thieno[3,2-d]pyrimidine.
| Compound Name | 4-chloro-7-[[2,6-difluoro-3-[4-(4-methoxyphenyl)butyl-sulfinatoamino]phenyl]carbamoyl]thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 86666979 |
| Molecular Formula | C24H20ClF2N4O4S2- |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 4-chloro-7-[[2,6-difluoro-3-[4-(4-methoxyphenyl)butyl-sulfinatoamino]phenyl]carbamoyl]thieno[3,2-d]pyrimidine |
| SMILES | COc1ccc(CCCCN(c2ccc(F)c(NC(=O)c3csc4c(Cl)ncnc34)c2F)S(=O)[O-])cc1 |
| InChI | InChI=1S/C24H21ClF2N4O4S2/c1-35-15-7-5-14(6-8-15)4-2-3-11-31(37(33)34)18-10-9-17(26)21(19(18)27)30-24(32)16-12-36-22-20(16)28-13-29-23(22)25/h5-10,12-13H,2-4,11H2,1H3,(H,30,32)(H,33,34)/p-1 |
| InChIKey | WEHLTWLWJXPVNP-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|