C25H31F3N4O2S — CID 86667026
N-butyl-N,1,9-trimethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine;2,2,2-trifluoroacetate (PubChem CID 86667026) has the molecular formula C25H31F3N4O2S and a molecular weight of 508.61 g/mol. Its IUPAC name is N-butyl-N,1,9-trimethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine;2,2,2-trifluoroacetate.
| Compound Name | N-butyl-N,1,9-trimethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 86667026 |
| Molecular Formula | C25H31F3N4O2S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | N-butyl-N,1,9-trimethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine;2,2,2-trifluoroacetate |
| SMILES | CCCCN(C)c1cc(C)c2nc3c(C)cc(=[N+]4CCNCC4)cc-3sc2c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H31N4S.C2HF3O2/c1-5-6-9-26(4)18-12-16(2)22-20(14-18)28-21-15-19(13-17(3)23(21)25-22)27-10-7-24-8-11-27;3-2(4,5)1(6)7/h12-15,24H,5-11H2,1-4H3;(H,6,7)/q+1;/p-1 |
| InChIKey | UVVGTOHRODEWDV-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|