About 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium
2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium (PubChem CID 86667161) has the molecular formula C32H35F3NO4S2+
and a molecular weight of 618.76 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium |
| PubChem CID | 86667161 |
| Molecular Formula | C32H35F3NO4S2+ |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium |
| SMILES | O=C(OCCNS(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H20F3NO4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-14(16,17)23(20,21)18-1-2-22-12(19)13-6-9-3-10(7-13)5-11(4-9)8-13/h1-15H;9-11,18H,1-8H2/q+1; |
| InChIKey | HYBWZXXRGHDFCU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium?
The IUPAC name of 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium (CID 86667161) is 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium.
What is the SMILES notation for 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium?
The canonical SMILES for 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium is O=C(OCCNS(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium?
The InChIKey is HYBWZXXRGHDFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C14H20F3NO4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-14(16,17)23(20,21)18-1-2-22-12(19)13-6-9-3-10(7-13)5-11(4-9)8-13/h1-15H;9-11,18H,1-8H2/q+1;.
What are the key properties of 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium?
2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium has a molecular weight of 618.76 g/mol, XLogP of 6.97, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethylsulfonylamino)ethyl adamantane-1-carboxylate;triphenylsulfanium is sourced from PubChem (CID 86667161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).