C21H26N6O — CID 86667179
(3-ethynylpyrrolidin-1-yl)-[1-(12-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone (PubChem CID 86667179) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is (3-ethynylpyrrolidin-1-yl)-[1-(12-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone.
| Compound Name | (3-ethynylpyrrolidin-1-yl)-[1-(12-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 86667179 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (3-ethynylpyrrolidin-1-yl)-[1-(12-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone |
| SMILES | C#CC1CCN(C(=O)C2CN(c3c4c(nc5ccnn35)CCN(C)CC4)C2)C1 |
| InChI | InChI=1S/C21H26N6O/c1-3-15-5-11-25(12-15)21(28)16-13-26(14-16)20-17-6-9-24(2)10-7-18(17)23-19-4-8-22-27(19)20/h1,4,8,15-16H,5-7,9-14H2,2H3 |
| InChIKey | JEGDTJXPINQOBD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|