C31H30N4O4S — CID 86667204
[3-[4-amino-5-(3-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylbenzenesulfonate (PubChem CID 86667204) has the molecular formula C31H30N4O4S and a molecular weight of 554.67 g/mol. Its IUPAC name is [3-[4-amino-5-(3-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[4-amino-5-(3-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86667204 |
| Molecular Formula | C31H30N4O4S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | [3-[4-amino-5-(3-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(n3cc(-c4cccc(OCc5ccccc5)c4)c4c(N)ncnc43)C2)cc1 |
| InChI | InChI=1S/C31H30N4O4S/c1-21-10-12-27(13-11-21)40(36,37)39-19-23-14-25(15-23)35-17-28(29-30(32)33-20-34-31(29)35)24-8-5-9-26(16-24)38-18-22-6-3-2-4-7-22/h2-13,16-17,20,23,25H,14-15,18-19H2,1H3,(H2,32,33,34) |
| InChIKey | VOYPUCCGJIOICV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|