C23H32F21N7 — CID 86667391
1,4,7,10,13,17,20-heptakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane (PubChem CID 86667391) has the molecular formula C23H32F21N7 and a molecular weight of 805.52 g/mol. Its IUPAC name is 1,4,7,10,13,17,20-heptakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane.
| Compound Name | 1,4,7,10,13,17,20-heptakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
|---|---|
| PubChem CID | 86667391 |
| Molecular Formula | C23H32F21N7 |
| Molecular Weight | 805.52 g/mol |
| Exact Mass | 805.24 |
| IUPAC Name | 1,4,7,10,13,17,20-heptakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
| SMILES | FC(F)(F)N1CCCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C(F)(F)F)CCCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H32F21N7/c24-17(25,26)45-3-1-5-47(19(30,31)32)9-11-49(21(36,37)38)13-15-51(23(42,43)44)16-14-50(22(39,40)41)12-10-48(20(33,34)35)6-2-4-46(8-7-45)18(27,28)29/h1-16H2 |
| InChIKey | SBDMARFQTJONEV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 22.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|