About 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine
2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine (PubChem CID 86667430) has the molecular formula C11H13ClFN3O
and a molecular weight of 257.70 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine |
| PubChem CID | 86667430 |
| Molecular Formula | C11H13ClFN3O |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1N[C@H]1CCC[C@]2(CO2)C1 |
| InChI | InChI=1S/C11H13ClFN3O/c12-10-14-5-8(13)9(16-10)15-7-2-1-3-11(4-7)6-17-11/h5,7H,1-4,6H2,(H,14,15,16)/t7-,11+/m0/s1 |
| InChIKey | KAGZVHNMJFRQHW-WRWORJQWSA-N |
| XLogP | 2.39 |
| TPSA | 50.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine?
The IUPAC name of 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine (CID 86667430) is 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine is Fc1cnc(Cl)nc1N[C@H]1CCC[C@]2(CO2)C1.
What is the InChIKey of 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine?
The InChIKey is KAGZVHNMJFRQHW-WRWORJQWSA-N. The full InChI is InChI=1S/C11H13ClFN3O/c12-10-14-5-8(13)9(16-10)15-7-2-1-3-11(4-7)6-17-11/h5,7H,1-4,6H2,(H,14,15,16)/t7-,11+/m0/s1.
What are the key properties of 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine?
2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine has a molecular weight of 257.70 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-N-[(3R,5S)-1-oxaspiro[2.5]octan-5-yl]pyrimidin-4-amine is sourced from PubChem (CID 86667430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).