About trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate
trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate (PubChem CID 86667436) has the molecular formula C13H17ClFN3O2
and a molecular weight of 301.75 g/mol. Its IUPAC name is trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate |
| PubChem CID | 86667436 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C13H17ClFN3O2/c1-13(11(19)20-2)5-3-4-8(6-13)17-10-9(15)7-16-12(14)18-10/h7-8H,3-6H2,1-2H3,(H,16,17,18)/t8-,13+/m0/s1 |
| InChIKey | UMDCVSMFBLZBSA-ISVAXAHUSA-N |
| XLogP | 2.80 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate?
The IUPAC name of trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate (CID 86667436) is trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate is COC(=O)[C@]1(C)CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate?
The InChIKey is UMDCVSMFBLZBSA-ISVAXAHUSA-N. The full InChI is InChI=1S/C13H17ClFN3O2/c1-13(11(19)20-2)5-3-4-8(6-13)17-10-9(15)7-16-12(14)18-10/h7-8H,3-6H2,1-2H3,(H,16,17,18)/t8-,13+/m0/s1.
What are the key properties of trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate?
trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate has a molecular weight of 301.75 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 86667436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).