About cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid
cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 86667448) has the molecular formula C11H13ClFN3O2
and a molecular weight of 273.69 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 86667448 |
| Molecular Formula | C11H13ClFN3O2 |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C11H13ClFN3O2/c12-11-14-5-8(13)9(16-11)15-7-3-1-2-6(4-7)10(17)18/h5-7H,1-4H2,(H,17,18)(H,14,15,16)/t6-,7+/m1/s1 |
| InChIKey | WFQDOCKAWNSSQW-RQJHMYQMSA-N |
| XLogP | 2.32 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid (CID 86667448) is cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid is O=C(O)[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid?
The InChIKey is WFQDOCKAWNSSQW-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H13ClFN3O2/c12-11-14-5-8(13)9(16-11)15-7-3-1-2-6(4-7)10(17)18/h5-7H,1-4H2,(H,17,18)(H,14,15,16)/t6-,7+/m1/s1.
What are the key properties of cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid?
cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid has a molecular weight of 273.69 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 86667448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).