About cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine
cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine (PubChem CID 86667454) has the molecular formula C10H14ClFN4
and a molecular weight of 244.70 g/mol. Its IUPAC name is cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine |
| PubChem CID | 86667454 |
| Molecular Formula | C10H14ClFN4 |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine |
| SMILES | N[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C10H14ClFN4/c11-10-14-5-8(12)9(16-10)15-7-3-1-2-6(13)4-7/h5-7H,1-4,13H2,(H,14,15,16)/t6-,7+/m1/s1 |
| InChIKey | BJESDUDDDWYDHV-RQJHMYQMSA-N |
| XLogP | 1.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine?
The IUPAC name of cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine (CID 86667454) is cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine.
What is the SMILES notation for cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine?
The canonical SMILES for cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine is N[C@@H]1CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine?
The InChIKey is BJESDUDDDWYDHV-RQJHMYQMSA-N. The full InChI is InChI=1S/C10H14ClFN4/c11-10-14-5-8(12)9(16-10)15-7-3-1-2-6(13)4-7/h5-7H,1-4,13H2,(H,14,15,16)/t6-,7+/m1/s1.
What are the key properties of cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine?
cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine has a molecular weight of 244.70 g/mol, XLogP of 1.95, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-1-N-(2-chloro-5-fluoropyrimidin-4-yl)cyclohexane-1,3-diamine is sourced from PubChem (CID 86667454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).