About N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline
N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline (PubChem CID 86667578) has the molecular formula C23H31NOS
and a molecular weight of 369.57 g/mol. Its IUPAC name is N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline.
Molecular Properties
| Compound Name | N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline |
| PubChem CID | 86667578 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline |
| SMILES | CCCCN(CCCC)c1ccc(C=CC=Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C23H31NOS/c1-4-6-16-24(17-7-5-2)21-15-14-20(23(19-21)25-3)11-8-9-12-22-13-10-18-26-22/h8-15,18-19H,4-7,16-17H2,1-3H3 |
| InChIKey | GZJZVUUKRRZQNM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline?
The IUPAC name of N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline (CID 86667578) is N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline.
What is the SMILES notation for N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline?
The canonical SMILES for N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline is CCCCN(CCCC)c1ccc(C=CC=Cc2cccs2)c(OC)c1.
What is the InChIKey of N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline?
The InChIKey is GZJZVUUKRRZQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NOS/c1-4-6-16-24(17-7-5-2)21-15-14-20(23(19-21)25-3)11-8-9-12-22-13-10-18-26-22/h8-15,18-19H,4-7,16-17H2,1-3H3.
What are the key properties of N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline?
N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline has a molecular weight of 369.57 g/mol, XLogP of 6.89, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-3-methoxy-4-(4-thiophen-2-ylbuta-1,3-dienyl)aniline is sourced from PubChem (CID 86667578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).