C33H52ClN5O4Si2 — CID 86667836
ethyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate (PubChem CID 86667836) has the molecular formula C33H52ClN5O4Si2 and a molecular weight of 674.44 g/mol. Its IUPAC name is ethyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86667836 |
| Molecular Formula | C33H52ClN5O4Si2 |
| Molecular Weight | 674.44 g/mol |
| Exact Mass | 673.32 |
| IUPAC Name | ethyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Cc2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(Cl)nc4)c3n2)CC1 |
| InChI | InChI=1S/C33H52ClN5O4Si2/c1-8-43-33(40)26-11-9-25(10-12-26)19-28-20-31(39-32(37-28)29(22-36-39)27-13-14-30(34)35-21-27)38(23-41-15-17-44(2,3)4)24-42-16-18-45(5,6)7/h13-14,20-22,25-26H,8-12,15-19,23-24H2,1-7H3 |
| InChIKey | AQSBWCIXPMAFSO-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.44 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|