About methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate
methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate (PubChem CID 86667925) has the molecular formula C10H10F3NO5S
and a molecular weight of 313.25 g/mol. Its IUPAC name is methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate |
| PubChem CID | 86667925 |
| Molecular Formula | C10H10F3NO5S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(OS(C)(=O)=O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H10F3NO5S/c1-18-9(15)7-4-3-6(5-14-7)8(10(11,12)13)19-20(2,16)17/h3-5,8H,1-2H3 |
| InChIKey | GWAWKBVKMMGQHV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate?
The IUPAC name of methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate (CID 86667925) is methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate is COC(=O)c1ccc(C(OS(C)(=O)=O)C(F)(F)F)cn1.
What is the InChIKey of methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate?
The InChIKey is GWAWKBVKMMGQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO5S/c1-18-9(15)7-4-3-6(5-14-7)8(10(11,12)13)19-20(2,16)17/h3-5,8H,1-2H3.
What are the key properties of methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate?
methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate has a molecular weight of 313.25 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,2,2-trifluoro-1-methylsulfonyloxyethyl)pyridine-2-carboxylate is sourced from PubChem (CID 86667925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).