C7H4F12O3 — CID 86668230
2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]propan-1-ol (PubChem CID 86668230) has the molecular formula C7H4F12O3 and a molecular weight of 364.08 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]propan-1-ol.
| Compound Name | 2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 86668230 |
| Molecular Formula | C7H4F12O3 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]propan-1-ol |
| SMILES | OCC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C7H4F12O3/c8-2(3(9,10)1-20)21-5(13,14)4(11,12)6(15,16)22-7(17,18)19/h2,20H,1H2 |
| InChIKey | OVOAULABUSUXHV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|