About trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane
trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane (PubChem CID 86668734) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane |
| PubChem CID | 86668734 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane |
| SMILES | C=C(/C=C/CCCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-6-7-8-9-10-11-12(2)13-14(3,4)5/h10-11H,2,6-9H2,1,3-5H3/b11-10+ |
| InChIKey | RAXUQPBXXCVQQJ-ZHACJKMWSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane?
The IUPAC name of trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane (CID 86668734) is trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane.
What is the SMILES notation for trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane?
The canonical SMILES for trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane is C=C(/C=C/CCCCC)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane?
The InChIKey is RAXUQPBXXCVQQJ-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H24OSi/c1-6-7-8-9-10-11-12(2)13-14(3,4)5/h10-11H,2,6-9H2,1,3-5H3/b11-10+.
What are the key properties of trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane?
trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane has a molecular weight of 212.41 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(3E)-nona-1,3-dien-2-yl]oxysilane is sourced from PubChem (CID 86668734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).