C24H28FN3O7S — CID 86668778
(2R)-4-[4-[4-[(5R)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 86668778) has the molecular formula C24H28FN3O7S and a molecular weight of 521.57 g/mol. Its IUPAC name is (2R)-4-[4-[4-[(5R)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[4-[4-[(5R)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 86668778 |
| Molecular Formula | C24H28FN3O7S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (2R)-4-[4-[4-[(5R)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(=O)NC[C@@H]1CN(c2ccc(-c3ccc(CC[C@](C)(C(=O)NO)S(C)(=O)=O)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H28FN3O7S/c1-15(29)26-13-19-14-28(23(31)35-19)18-8-9-20(21(25)12-18)17-6-4-16(5-7-17)10-11-24(2,22(30)27-32)36(3,33)34/h4-9,12,19,32H,10-11,13-14H2,1-3H3,(H,26,29)(H,27,30)/t19-,24-/m1/s1 |
| InChIKey | OOVQXTFCMSSJEW-NTKDMRAZSA-N |
| XLogP | 2.20 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|