C12H15ClFNO — CID 86669069
1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanamine (PubChem CID 86669069) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanamine.
| Compound Name | 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanamine |
|---|---|
| PubChem CID | 86669069 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanamine |
| SMILES | CONC(C)[C@@H]1C[C@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C12H15ClFNO/c1-7(15-16-2)8-6-9(8)12-10(13)4-3-5-11(12)14/h3-5,7-9,15H,6H2,1-2H3/t7?,8-,9+/m0/s1 |
| InChIKey | HLZSPMHLFLXURM-SXNZSPLWSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|