C12H13ClFNO — CID 86669070
1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanimine (PubChem CID 86669070) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanimine.
| Compound Name | 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 86669070 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-[(1R,2R)-2-(2-chloro-6-fluorophenyl)cyclopropyl]-N-methoxyethanimine |
| SMILES | CON=C(C)[C@@H]1C[C@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C12H13ClFNO/c1-7(15-16-2)8-6-9(8)12-10(13)4-3-5-11(12)14/h3-5,8-9H,6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | FDRAITCEFKGWEH-DTWKUNHWSA-N |
| XLogP | 3.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|