C21H24N2O5 — CID 86669230
propan-2-yl N-[(2S,4R)-1-acetyl-6-(4-formylfuran-2-yl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate (PubChem CID 86669230) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is propan-2-yl N-[(2S,4R)-1-acetyl-6-(4-formylfuran-2-yl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S,4R)-1-acetyl-6-(4-formylfuran-2-yl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 86669230 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | propan-2-yl N-[(2S,4R)-1-acetyl-6-(4-formylfuran-2-yl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
| SMILES | CC(=O)N1c2ccc(-c3cc(C=O)co3)cc2[C@H](NC(=O)OC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C21H24N2O5/c1-12(2)28-21(26)22-18-7-13(3)23(14(4)25)19-6-5-16(9-17(18)19)20-8-15(10-24)11-27-20/h5-6,8-13,18H,7H2,1-4H3,(H,22,26)/t13-,18+/m0/s1 |
| InChIKey | LMVVARZNBSVJIE-SCLBCKFNSA-N |
| XLogP | 4.08 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|