About methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate
methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate (PubChem CID 86669289) has the molecular formula C9H8ClF2NO3
and a molecular weight of 251.62 g/mol. Its IUPAC name is methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate |
| PubChem CID | 86669289 |
| Molecular Formula | C9H8ClF2NO3 |
| Molecular Weight | 251.62 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)nc1OCC(F)F |
| InChI | InChI=1S/C9H8ClF2NO3/c1-15-9(14)5-2-3-6(10)13-8(5)16-4-7(11)12/h2-3,7H,4H2,1H3 |
| InChIKey | CQMKEANVAMTZQT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate?
The IUPAC name of methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate (CID 86669289) is methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate?
The canonical SMILES for methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate is COC(=O)c1ccc(Cl)nc1OCC(F)F.
What is the InChIKey of methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate?
The InChIKey is CQMKEANVAMTZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF2NO3/c1-15-9(14)5-2-3-6(10)13-8(5)16-4-7(11)12/h2-3,7H,4H2,1H3.
What are the key properties of methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate?
methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate has a molecular weight of 251.62 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylate is sourced from PubChem (CID 86669289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).