C20H21F2N3O2 — CID 86669673
(2R,4R)-9-(2,4-difluorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 86669673) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 86669673 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | O=C(NC1(CO)CCCC1)c1nn(-c2ccc(F)cc2F)c2c1C[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C20H21F2N3O2/c21-12-3-4-16(15(22)9-12)25-18-13-7-11(13)8-14(18)17(24-25)19(27)23-20(10-26)5-1-2-6-20/h3-4,9,11,13,26H,1-2,5-8,10H2,(H,23,27)/t11-,13-/m1/s1 |
| InChIKey | PBMFBAGKYCXWOV-DGCLKSJQSA-N |
| XLogP | 2.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |