C22H26F2N4O — CID 86669674
(2R,4R)-9-(2,4-difluorophenyl)-N-[1-[(dimethylamino)methyl]cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 86669674) has the molecular formula C22H26F2N4O and a molecular weight of 400.47 g/mol. Its IUPAC name is (2R,4R)-9-(2,4-difluorophenyl)-N-[1-[(dimethylamino)methyl]cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-[(dimethylamino)methyl]cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 86669674 |
| Molecular Formula | C22H26F2N4O |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-[(dimethylamino)methyl]cyclopentyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CN(C)CC1(NC(=O)c2nn(-c3ccc(F)cc3F)c3c2C[C@H]2C[C@@H]32)CCCC1 |
| InChI | InChI=1S/C22H26F2N4O/c1-27(2)12-22(7-3-4-8-22)25-21(29)19-16-10-13-9-15(13)20(16)28(26-19)18-6-5-14(23)11-17(18)24/h5-6,11,13,15H,3-4,7-10,12H2,1-2H3,(H,25,29)/t13-,15-/m1/s1 |
| InChIKey | UMXDYOMSOKXHSK-UKRRQHHQSA-N |
| XLogP | 3.41 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |